(S,R,S)-AHPC-C8-NH2 dihydrochloride structure
|
Common Name | (S,R,S)-AHPC-C8-NH2 dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2341796-80-1 | Molecular Weight | 658.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H49Cl2N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S,R,S)-AHPC-C8-NH2 dihydrochloride(S,R,S)-AHPC-C8-NH2 dihydrochloride (VH032-C8-NH2 dihydrochloride) is a synthesized E3 ligase ligand-linker conjugate that incorporates the VH032 based VHL ligand and a linker used for AKT PROTAC degrader. (S,R,S)-AHPC-C8-NH2 is XF038-164A, example 8, extracted from patent WO2019173516A1[1]. |
| Name | (S,R,S)-AHPC-C8-NH2 dihydrochloride |
|---|
| Description | (S,R,S)-AHPC-C8-NH2 dihydrochloride (VH032-C8-NH2 dihydrochloride) is a synthesized E3 ligase ligand-linker conjugate that incorporates the VH032 based VHL ligand and a linker used for AKT PROTAC degrader. (S,R,S)-AHPC-C8-NH2 is XF038-164A, example 8, extracted from patent WO2019173516A1[1]. |
|---|---|
| Related Catalog | |
| Target |
VHL |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C31H49Cl2N5O4S |
|---|---|
| Molecular Weight | 658.72 |
| InChIKey | RBLHRVOQDCWDGC-UHFFFAOYSA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCCCCCCCN)C(C)(C)C)cc1.Cl.Cl |
| Hazard Codes | Xi |
|---|