VH 032 amide-PEG1-amine structure
|
Common Name | VH 032 amide-PEG1-amine | ||
|---|---|---|---|---|
| CAS Number | 2341796-83-4 | Molecular Weight | 604.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H39Cl2N5O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VH 032 amide-PEG1-amineVH032-PEG1-NH2 hydrochloride incorporates a VHL ligand for the E3 ubiquitin ligase, and a PROTAC linker. VH032-PEG1-NH2 hydrochloride can be used to design PROTACs[1]. |
| Name | VH032-PEG1-NH2 dihydrochloride |
|---|
| Description | VH032-PEG1-NH2 hydrochloride incorporates a VHL ligand for the E3 ubiquitin ligase, and a PROTAC linker. VH032-PEG1-NH2 hydrochloride can be used to design PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
VHL |
| References |
| Molecular Formula | C26H39Cl2N5O5S |
|---|---|
| Molecular Weight | 604.59 |
| InChIKey | DKKLDTGWCBYLGT-YEMZLKFISA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)COCCN)C(C)(C)C)cc1.Cl.Cl |
| Hazard Codes | Xi |
|---|