Thalidomide 4'-ether-alkylC2-amine hydrochloride structure
|
Common Name | Thalidomide 4'-ether-alkylC2-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2341840-99-9 | Molecular Weight | 353.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide 4'-ether-alkylC2-amine hydrochloridePomalidomide-PEG1-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 1-unit PEG linker used in PROTAC technology[1]. |
| Name | Pomalidomide-PEG1-NH2 hydrochloride |
|---|
| Description | Pomalidomide-PEG1-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 1-unit PEG linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C15H16ClN3O5 |
|---|---|
| Molecular Weight | 353.76 |
| InChIKey | AZQNUQDFOMUSBB-UHFFFAOYSA-N |
| SMILES | Cl.NCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Hazard Codes | Xi |
|---|