o-Chloro-N-(p-methoxyphenyl)benzamidine structure
|
Common Name | o-Chloro-N-(p-methoxyphenyl)benzamidine | ||
|---|---|---|---|---|
| CAS Number | 23564-74-1 | Molecular Weight | 104.57800 | |
| Density | 1.19g/cm3 | Boiling Point | 424ºC at 760mmHg | |
| Molecular Formula | C5H9Cl | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2ºC | |
| Name | 2-(chloromethyl)but-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 424ºC at 760mmHg |
| Molecular Formula | C5H9Cl |
| Molecular Weight | 104.57800 |
| Flash Point | 210.2ºC |
| Exact Mass | 104.03900 |
| LogP | 2.19140 |
| Vapour Pressure | 2.14E-07mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | VOMBBOUDYICEKU-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C(N)c2ccccc2Cl)cc1 |
| HS Code | 2925290090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Chloro-2-ethyl-1-propene |
| Methoxy-4'-phenyl-chloro-1-benzamidin |