Glycine, N-phenyl-N-(phenylmethyl)- structure
|
Common Name | Glycine, N-phenyl-N-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 23582-63-0 | Molecular Weight | 241.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(N-benzylanilino)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15NO2 |
|---|---|
| Molecular Weight | 241.28500 |
| Exact Mass | 241.11000 |
| PSA | 40.54000 |
| LogP | 2.77780 |
| InChIKey | KUPDILJKKXVBLS-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(Cc1ccccc1)c1ccccc1 |
| HS Code | 2922499990 |
|---|
|
~%
Glycine, N-phen... CAS#:23582-63-0 |
| Literature: Stranix, Brent R.; Sauve, Gilles; Bouzide, Abderrahim; Cote, Alexandre; Sevigny, Guy; Yelle, Jocelyn Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 24 p. 4289 - 4292 |
|
~%
Glycine, N-phen... CAS#:23582-63-0 |
| Literature: Bischoff Chemische Berichte, 1898 , vol. 31, p. 2674 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzylanilinoessigsaeure |
| benzyl N-phenylglycine |
| GLY005 |
| N-benzyl-N-phenylglycine |
| Phenylbenzylaminoessigsaeure |
| N-Benzyl-N-phenyl-glycin |