2-Propenamide,N,N'-methylenebis[2-methyl- structure
|
Common Name | 2-Propenamide,N,N'-methylenebis[2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 2359-15-1 | Molecular Weight | 182.22000 | |
| Density | 1.019g/cm3 | Boiling Point | 443.1ºC at 760mmHg | |
| Molecular Formula | C9H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
| Name | 2-methyl-N-[(2-methylprop-2-enoylamino)methyl]prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 443.1ºC at 760mmHg |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22000 |
| Flash Point | 198.6ºC |
| Exact Mass | 182.10600 |
| PSA | 58.20000 |
| LogP | 1.11030 |
| Vapour Pressure | 4.77E-08mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | TURITJIWSQEMDB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)NCNC(=O)C(=C)C |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2924199090 |
|
~%
2-Propenamide,N... CAS#:2359-15-1 |
| Literature: Journal of the American Chemical Society, , vol. 75, p. 5027 |
|
~%
2-Propenamide,N... CAS#:2359-15-1 |
| Literature: Journal of the American Chemical Society, , vol. 75, p. 5027 US2475846 , ; |
|
~%
2-Propenamide,N... CAS#:2359-15-1 |
| Literature: Journal of the American Chemical Society, , vol. 75, p. 5027 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| bis-methacryloylamino-methane |
| N,N'-Methylenebismethacrylamide |
| N,N'-Methylenebis(2-methyl-2-propenamide) |
| 2-Propenamide,N,N'-methylenebis(2-methyl |
| n,n'-methylenebis(2-methylacrylamide) |
| N,N'-Dimethacryloyl-methylendiamin |
| EINECS 219-102-3 |
| N,N'-methylenebisacrylamide |
| Bis-methacryloylamino-methan |