3-(2-Chlorophenyl)-5-methylisoxazole-4-carboxylic acid structure
|
Common Name | 3-(2-Chlorophenyl)-5-methylisoxazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 23598-72-3 | Molecular Weight | 237.63900 | |
| Density | 1.385 g/cm3 | Boiling Point | 374.5ºC at 760 mmHg | |
| Molecular Formula | C11H8ClNO3 | Melting Point | 186-189ºC | |
| MSDS | N/A | Flash Point | 180.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.385 g/cm3 |
|---|---|
| Boiling Point | 374.5ºC at 760 mmHg |
| Melting Point | 186-189ºC |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.63900 |
| Flash Point | 180.3ºC |
| Exact Mass | 237.01900 |
| PSA | 63.33000 |
| LogP | 3.00160 |
| Vapour Pressure | 2.83E-06mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | UVEPOHNXGXVOJE-UHFFFAOYSA-N |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S22-S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
|
~%
3-(2-Chlorophen... CAS#:23598-72-3 |
| Literature: WO2012/164355 A1, ; Page/Page column 9-10 ; |
|
~99%
3-(2-Chlorophen... CAS#:23598-72-3 |
| Literature: Xin, Zhili; Zhao, Hongyu; Serby, Michael D.; Liu, Bo; Schaefer, Verlyn G.; Falls, Douglas H.; Kaszubska, Wiweka; Colins, Christine A.; Sham, Hing L.; Liu, Gang Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 4 p. 1201 - 1204 |
|
~%
3-(2-Chlorophen... CAS#:23598-72-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 4 p. 1201 - 1204 |
|
~%
3-(2-Chlorophen... CAS#:23598-72-3 |
| Literature: Journal of the Chemical Society, , p. 5838 - 5845 |
|
~%
3-(2-Chlorophen... CAS#:23598-72-3 |
| Literature: Journal of the Chemical Society, , p. 5838 - 5845 |
|
~%
3-(2-Chlorophen... CAS#:23598-72-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 49, # 3 p. 621 - 627 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3(2-chlorophenyl)-5-methyl-isoxazolyl-4-carboxylic acid |
| 3-(2-chlorophenyl)-5-methylisoxazol-4-carboxylic acid |
| 3-(2-CHLOROPHENYL)-5-METHYL-4-ISOXAZOLECARBOXYLIC ACID |
| 5-methyl-3-(2'-chlorophenyl)-4-isoxazolecarboxylic acid |
| MFCD00020813 |
| 3-(2-Chlorophenyl)-5-methylisoxazole-4-carboxylic acid |
| [3-(2chlorophenyl)-5-methylisoxazol-4-yl]carboxylic acid |
| cmic acid |
| EINECS 245-770-0 |
| 4-Isoxazolecarboxylic acid,3-(o-chlorophenyl)-5-methyl |
| 3-(2-Chloro-phenyl)-5-methyl-isoxazole-4-carboxylic acid |
| 4-Isoxazolecarboxylic acid,3-(2-chlorophenyl)-5-methyl |