3-Nitro-1H-pyrrolo[2,3-b]pyridine structure
|
Common Name | 3-Nitro-1H-pyrrolo[2,3-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 23709-47-9 | Molecular Weight | 163.133 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 386.2ºC at 760mmHg | |
| Molecular Formula | C7H5N3O2 | Melting Point | >300ºC | |
| MSDS | Chinese USA | Flash Point | 187.3ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 3-nitro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.2ºC at 760mmHg |
| Melting Point | >300ºC |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.133 |
| Flash Point | 187.3ºC |
| Exact Mass | 163.038177 |
| PSA | 74.50000 |
| LogP | 1.60 |
| Vapour Pressure | 8.03E-06mmHg at 25°C |
| Index of Refraction | 1.741 |
| InChIKey | DTLVPICXPRRMOQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c[nH]c2ncccc12 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 26 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2933990090 |
|
~%
3-Nitro-1H-pyrr... CAS#:23709-47-9 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 743,746 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Nitro-1H-pyrrolo[2,3-b]pyridine |
| 3-Nitro-1H-pyrrolo<pyridin |
| 3-Nitro-1H-pyrrolo[2,3-b]pyridin |
| 3-NITRO-7-AZAINDOLE |
| 3-nitro-1H-pyrrolo<2,3-b>pyridine |
| 1H-PYRROLO[2,3-B]PYRIDINE,3-NITRO |
| 3-Nitropyrrolo<3-nitro-7-azaindole |
| nitropyrrolobpyridine |