Fenmetozole hydrochloride structure
|
Common Name | Fenmetozole hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 23712-05-2 | Molecular Weight | 281.57 | |
| Density | 1.43g/cm3 | Boiling Point | 430ºC at 760mmHg | |
| Molecular Formula | C10H11Cl3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
Use of Fenmetozole hydrochlorideFenmetozole hydrochloride is an antagonist of ethanol, and also antagonizes α2-adrenergic receptor, which has antidepressant effect[1]. |
| Name | 2-[(3,4-dichlorophenoxy)methyl]-4,5-dihydro-1H-imidazole,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Fenmetozole hydrochloride is an antagonist of ethanol, and also antagonizes α2-adrenergic receptor, which has antidepressant effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 430ºC at 760mmHg |
| Molecular Formula | C10H11Cl3N2O |
| Molecular Weight | 281.57 |
| Flash Point | 213.8ºC |
| Exact Mass | 279.99400 |
| PSA | 33.62000 |
| LogP | 2.94030 |
| InChIKey | AOMZMOWSWJHDRD-UHFFFAOYSA-N |
| SMILES | Cl.Clc1ccc(OCC2=NCCN2)cc1Cl |
| 2-((3,4-Dichlorophenoxy)methyl)-2-imidazoline hydrochloride |
| 1H-Imidazole,2-((3,4-dichlorophenoxy)methyl)-4,5-dihydro-,monohydrochloride |
| Fenmetozole HCl |
| Fenmetozole hydrochloride |
| DH 524 (pharmaceutical) |
| Fenmetozole hydrochloride (USAN) |
| DH-524 |
| 2-IMIDAZOLINE,2-((3,4-DICHLOROPHENOXY)METHYL)-,MONOHYDROCHLORIDE |