Pregn-4-ene-3,20-dione,16a-(nitromethyl)- (8CI) structure
|
Common Name | Pregn-4-ene-3,20-dione,16a-(nitromethyl)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 23738-15-0 | Molecular Weight | 373.48600 | |
| Density | 1.17g/cm3 | Boiling Point | 530.7ºC at 760mmHg | |
| Molecular Formula | C22H31NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.8ºC | |
| Name | 16alpha-Methylprogesterone |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 530.7ºC at 760mmHg |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.48600 |
| Flash Point | 234.8ºC |
| Exact Mass | 373.22500 |
| PSA | 79.96000 |
| LogP | 4.74950 |
| Vapour Pressure | 2.41E-11mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | JDTTYBKAUCAYDW-POJZBZBFSA-N |
| SMILES | CC(=O)C1C(C[N+](=O)[O-])CC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
|
~%
Pregn-4-ene-3,2... CAS#:23738-15-0 |
| Literature: Searle and Co. Patent: US2697109 , 1953 ; |
|
~%
Pregn-4-ene-3,2... CAS#:23738-15-0 |
| Literature: Searle and Co. Patent: US2697109 , 1953 ; |
|
~%
Pregn-4-ene-3,2... CAS#:23738-15-0 |
| Literature: Searle and Co. Patent: US2697109 , 1953 ; |
|
~%
Pregn-4-ene-3,2... CAS#:23738-15-0 |
| Literature: Searle and Co. Patent: US2697109 , 1953 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |