4-methyl-3-nitrobenzyl alcohol structure
|
Common Name | 4-methyl-3-nitrobenzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 40870-59-5 | Molecular Weight | 167.16200 | |
| Density | 1.272g/cm3 | Boiling Point | 320ºC at 760mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 39-41ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 143.9ºC | |
| Name | 4-methyl-3-nitrobenzyl alcohol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 320ºC at 760mmHg |
| Melting Point | 39-41ºC(lit.) |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16200 |
| Flash Point | 143.9ºC |
| Exact Mass | 167.05800 |
| PSA | 66.05000 |
| LogP | 1.91870 |
| Index of Refraction | 1.585 |
| InChIKey | URCWIFSXDARYLY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CO)cc1[N+](=O)[O-] |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2906299090 |
|
~%
4-methyl-3-nitr... CAS#:40870-59-5 |
| Literature: Bayer CorpScience AG Patent: US2010/179194 A1, 2010 ; Location in patent: Page/Page column 25 ; |
|
~%
4-methyl-3-nitr... CAS#:40870-59-5 |
| Literature: Auwers Justus Liebigs Annalen der Chemie, 1906 , vol. 344, p. 179 |
|
~%
4-methyl-3-nitr... CAS#:40870-59-5 |
| Literature: Fuchs,R.; Carlton,D.M. Journal of Organic Chemistry, 1962 , vol. 27, p. 1520 - 1523 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-Methyl-3-nitro-benzylalkohol |
| 4-methyl-3-nitro-benzyl alcohol |
| EINECS 255-120-8 |
| RARECHEM AL BD 0233 |
| Benzenemethanol,4-methyl-3-nitro |
| MFCD00007177 |
| 3-Nitro-4-methylbenzyl alcohol |
| 3-Nitro-11-oxy-1.4-dimethyl-benzol |