H-Gly-Trp-OH structure
|
Common Name | H-Gly-Trp-OH | ||
|---|---|---|---|---|
| CAS Number | 2390-74-1 | Molecular Weight | 261.276 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 621.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.9±31.5 °C | |
| Name | (2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoic acid,hydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 621.8±55.0 °C at 760 mmHg |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.276 |
| Flash Point | 329.9±31.5 °C |
| Exact Mass | 261.111328 |
| PSA | 108.21000 |
| LogP | 0.26 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | AJHCSUXXECOXOY-NSHDSACASA-N |
| SMILES | NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| Storage condition | -15°C |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-glycyl-L-tryptophan |
| DL-Tryptophan, N-glycyl- |
| EINECS 219-235-7 |
| N-Glycyltryptophan |
| Glycyl-L-tryptophan |
| α-(Aminoacetyl)tryptophan |
| H-GLY-TRP-OH |
| Tryptophan, α-(2-aminoacetyl)- |
| L-Gly-L-Trp-OH |
| L-Tryptophan, glycyl- |
| Gly-L-Trp-OH |
| L-Tryptophan, N-glycyl- |
| l-Glycyltryptophan |
| Glycyltryptophan |
| Gly-Trp-OH |
| Glycyl-L-tryptophan Hydrate |
| MFCD00065978 |
| GLY-TRP |