2,4-Dihydroxypyrimidine-5-carboxylic acid structure
|
Common Name | 2,4-Dihydroxypyrimidine-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 23945-44-0 | Molecular Weight | 156.096 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 564.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C5H4N2O4 | Melting Point | 283 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 295.4±32.9 °C | |
| Name | uracil-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 564.9±60.0 °C at 760 mmHg |
| Melting Point | 283 °C (dec.)(lit.) |
| Molecular Formula | C5H4N2O4 |
| Molecular Weight | 156.096 |
| Flash Point | 295.4±32.9 °C |
| Exact Mass | 156.017105 |
| PSA | 103.02000 |
| LogP | -1.43 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | ZXYAAVBXHKCJJB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c[nH]c(=O)[nH]c1=O |
| Storage condition | Refrigerator |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Naked eye sensing of melamine using rationally tailored gold nanoparticles: hydrogen-bonding and charge-transfer recognition.
Analyst 136(8) , 1644-8, (2011) A highly sensitive analytical method based on Au nanoparticles rationally tailored with recognition elements uracil-5-carboxylic acid (UCA) and 2,4,6-trinitrobenzenesulfonic acid (TNBS) for the visual... |
|
|
New uracil dimers showing erythroid differentiation inducing activities.
J. Med. Chem. 52 , 87-94, (2009) The synthesis of C5 linked uracil dimers was carried out according to a model developed in order to bind adenine in DNA. N1-Alkylated uracil derivatives were synthesized from isoorotic acid (uracil-5-... |
|
|
Metabolism of pyrimidine deoxyribonucleosides in Neurospora crassa.
J. Bacteriol. 121(2) , 648-55, (1975) The experiments in this report involve the following series of reactions which were previously demonstrated with purified enzyme preparations from Neurospora crassa: thymidine a yields thymine ribonuc... |
| 2,4-Dihydroxypyrimidine-5-carboxylic acid |
| 5-CARBOXYURACIL extrapure |
| Uracil-5-Carboxylic |
| 2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid |
| Uracil5-carboxylatehydrate |
| RARECHEM AL BO 2377 |
| isoorotic acid |
| URACIL-5-CARBOXYLIC ACID |
| EINECS 245-947-2 |
| MFCD00006023 |
| 2,4-Dioxo-1,2,3,4-tetrahydro-5-pyrimidinecarboxylic acid |
| 5-carboxyuracil |
| 5-CARBOXY-2,4-DIHYDROXYPYRIMIDINE |
| 1,2,3,4-tetrahydro-2,4-dioxopyrimidine-5-carboxylic acid |