R 138727 structure
|
Common Name | R 138727 | ||
|---|---|---|---|---|
| CAS Number | 239466-74-1 | Molecular Weight | 349.420 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 513.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H20FNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.3±30.1 °C | |
| Name | (2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 513.4±50.0 °C at 760 mmHg |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.420 |
| Flash Point | 264.3±30.1 °C |
| Exact Mass | 349.114807 |
| PSA | 96.41000 |
| LogP | 2.92 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | ZWUQVNSJSJHFPS-FMIVXFBMSA-N |
| SMILES | O=C(O)C=C1CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S |
| active metabolite of Prasugrel (CS-747) |
| Acetic acid,[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-mercapto-3-piperidinylidene]-,(Z) |
| ercapto-3-piperidinylidene]-,(2Z)-(9CI) |
| Prasugrel active metabolite |
| Prasugrel metabolite |
| (2Z)-{1-[2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanyl-3-piperidinylidene}acetic acid |
| Acetic acid,2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-mercapto-3-piperidinylidene]-,(2Z) |
| R 138727 |
| Acetic acid, 2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-mercapto-3-piperidinylidene]-, (2Z)- |
| R-138727 |