1-(4-(DIMETHYLAMINO)PHENYL)-2,2,2-TRIFLUOROETHANONE
Modify Date: 2025-08-25 19:44:11
1-(4-(DIMETHYLAMINO)PHENYL)-2,2,2-TRIFLUOROETHANONE structure
|
Common Name | 1-(4-(DIMETHYLAMINO)PHENYL)-2,2,2-TRIFLUOROETHANONE | ||
|---|---|---|---|---|
| CAS Number | 2396-05-6 | Molecular Weight | 217.18800 | |
| Density | 1.238g/cm3 | Boiling Point | 265.8ºC at 760 mmHg | |
| Molecular Formula | C10H10F3NO | Melting Point | 72-76ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 114.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 265.8ºC at 760 mmHg |
| Melting Point | 72-76ºC(lit.) |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.18800 |
| Flash Point | 114.5ºC |
| Exact Mass | 217.07100 |
| PSA | 20.31000 |
| LogP | 2.49760 |
| Vapour Pressure | 0.00898mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | NDKSWWUQHXZADC-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)C(F)(F)F)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922399090 |
|
~%
1-(4-(DIMETHYLA... CAS#:2396-05-6 |
| Literature: Journal of the American Chemical Society, , vol. 87, # 11 p. 2410 - 2420 |
|
~%
1-(4-(DIMETHYLA... CAS#:2396-05-6 |
| Literature: Journal of Organic Chemistry, , vol. 52, # 22 p. 5026 - 5030 |
|
~%
1-(4-(DIMETHYLA... CAS#:2396-05-6 |
| Literature: Tetrahedron, , vol. 27, p. 1221 - 1226 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Platinum-catalyzed enantioselective hydrogenation of aryl-substituted trifluoroacetophenones. von Arx M, et al.
Tetrahedron Asymmetry 12(22) , 3089-3094, (2001)
|
| 1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethan-1-one |
| 4'-(Dimethylamino)-2,2,2-trifluoroacetophenone |
| MFCD00099468 |
| 1-(4-(dimethylamino)phenyl)-2,2,2-trifluoroethanone |
| 4'-N,N-dimethylamino-2,2,2-trifluoroacetophenone |
| 4-dimethylaminotrifluoroacetophenone |