4-(heptafluoroisopropyl)toluene structure
|
Common Name | 4-(heptafluoroisopropyl)toluene | ||
|---|---|---|---|---|
| CAS Number | 2396-26-1 | Molecular Weight | 260.15100 | |
| Density | 1.34 g/cm3 | Boiling Point | 145.3ºC at 760 mmHg | |
| Molecular Formula | C10H7F7 | Melting Point | 148-149ºC | |
| MSDS | N/A | Flash Point | 42.9ºC | |
| Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34 g/cm3 |
|---|---|
| Boiling Point | 145.3ºC at 760 mmHg |
| Melting Point | 148-149ºC |
| Molecular Formula | C10H7F7 |
| Molecular Weight | 260.15100 |
| Flash Point | 42.9ºC |
| Exact Mass | 260.04400 |
| LogP | 4.28440 |
| Vapour Pressure | 6.16mmHg at 25°C |
| Index of Refraction | 1.395 |
| InChIKey | XEFRSBQTXVJYKZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R10 |
| Safety Phrases | S23 |
| RIDADR | UN 1993 |
| HS Code | 2903999090 |
|
~81%
4-(heptafluoroi... CAS#:2396-26-1 |
| Literature: Kitazume, Tomoya; Ishikawa, Nobuo Chemistry Letters, 1982 , p. 137 - 140 |
|
~%
4-(heptafluoroi... CAS#:2396-26-1 |
| Literature: Zhurnal Organicheskoi Khimii, , vol. 10, p. 503 - 509,506 - 511 |
|
~%
4-(heptafluoroi... CAS#:2396-26-1 |
| Literature: Journal of the American Chemical Society, , vol. 87, # 11 p. 2410 - 2420 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| p-(Heptafluoroisopropyl)toluene |
| 4-Heptafluorisopropyl-1-methylbenzol |
| 4-(Heptafluorisopropyl)-toluol |
| MFCD00041485 |
| p-Perfluorisopropyl-toluol |
| 4-(Heptafluoroisopropyl)toluene |
| p-Heptafluorisopropyl-toluol |
| PC4498D |