Tyrosinase-IN-3 structure
|
Common Name | Tyrosinase-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 2409081-40-7 | Molecular Weight | 369.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tyrosinase-IN-3Tyrosinase-IN-3 (compound 54) is a potent inhibitor of tyrosinase. Tyrosinase is a copper-containing metalloenzyme that is responsible for the rate-limiting catalytic step in the melanin biosynthesis and enzymatic browning. Tyrosinase-IN-3 has the potential for the research of skin whitening agents and food preservatives[1]. |
| Name | Tyrosinase-IN-3 |
|---|
| Description | Tyrosinase-IN-3 (compound 54) is a potent inhibitor of tyrosinase. Tyrosinase is a copper-containing metalloenzyme that is responsible for the rate-limiting catalytic step in the melanin biosynthesis and enzymatic browning. Tyrosinase-IN-3 has the potential for the research of skin whitening agents and food preservatives[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H23NO5 |
|---|---|
| Molecular Weight | 369.41 |
| InChIKey | XRKRGHISYFKGFJ-VQHVLOKHSA-N |
| SMILES | Cc1ccc(C(C)C)cc1NC(=O)COC(=O)C=Cc1ccc(O)cc1O |