Tyrosinase-IN-1 structure
|
Common Name | Tyrosinase-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1164200-43-4 | Molecular Weight | 267.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tyrosinase-IN-1Tyrosinase-IN-1 (compound 90) is a potent inhibitor of tyrosinase. Tyrosinase is a copper-containing metalloenzyme that is responsible for the rate-limiting catalytic step in the melanin biosynthesis and enzymatic browning. Tyrosinase-IN-1 has the potential for the research of skin whitening agents and food preservatives[1]. |
| Name | Tyrosinase-IN-1 |
|---|
| Description | Tyrosinase-IN-1 (compound 90) is a potent inhibitor of tyrosinase. Tyrosinase is a copper-containing metalloenzyme that is responsible for the rate-limiting catalytic step in the melanin biosynthesis and enzymatic browning. Tyrosinase-IN-1 has the potential for the research of skin whitening agents and food preservatives[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H9N3O2S2 |
|---|---|
| Molecular Weight | 267.33 |
| InChIKey | RNSYZQZFZRNFIW-VZUCSPMQSA-N |
| SMILES | COc1cc(C=Nc2n[nH]c(=S)s2)ccc1O |