(3,5-dimethoxyphenyl)methanol structure
|
Common Name | (3,5-dimethoxyphenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 24131-31-5 | Molecular Weight | 320.4 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 480.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C21H20O3 | Melting Point | 78-81 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 219.6±21.6 °C | |
| Name | 3,5-Dibenzyloxybenzyl alcohol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 480.2±40.0 °C at 760 mmHg |
| Melting Point | 78-81 °C(lit.) |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.4 |
| Flash Point | 219.6±21.6 °C |
| Exact Mass | 320.14124450 |
| PSA | 38.69000 |
| LogP | 4.59 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | MHHXKZKHZMSINU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)CO)OCC3=CC=CC=C3 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
9-Membered carbocycle formation: development of distinct Friedel-Crafts cyclizations and application to a scalable total synthesis of (±)-caraphenol A.
Angew. Chem. Int. Ed. Engl. 53(13) , 3409-13, (2014) Explorations into a series of different approaches for 9-membered carbocycle formation have afforded the first reported example of a 9-exo-dig ring closure via a Au(III)-promoted reaction between an a... |
|
|
B(C6F5)3: an efficient catalyst for reductive alkylation of alkoxy benzenes and for synthesis of triarylmethanes using aldehydes. Chandrasekhar S, et al.
Tetrahedron Lett. 50(48) , 6693-6697, (2009)
|
|
|
The structure and partial synthesis of imbricatine, a benzyltetrahydroisoquinoline alkaloid from the starfish Dermasterias imbricata. Burgoyne DL, et al.
Can. J. Chem. 69(1) , 20-27, (1991)
|
| 3,5-BENZYLOXYBENZYL ALCOHOL |
| 3,5-Dibenzylooxybenzyl alcohol |
| [3-Benzyl-5-(benzyloxy)phenyl]methanol |
| RARECHEM AL BD 0734 |
| 3,5-Dibenzyloxybenzyl alkohol |
| 3,5-Bis(benzyloxy)benzyl Alcohol |
| MFCD01863236 |
| (3,5-dimethoxyphenyl)methanol |