CBR-470-1 structure
|
Common Name | CBR-470-1 | ||
|---|---|---|---|---|
| CAS Number | 2416095-06-0 | Molecular Weight | 365.90 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20ClNO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CBR-470-1CBR-470-1 is an inhibitor of the glycolytic enzyme phosphoglycerate kinase 1 (PGK1). CBR-470-1 is also a non-covalent Nrf2 activator. CBR-470-1 protects SH-SY5Y neuronal cells against MPP+-induced cytotoxicity through activation of the Keap1-Nrf2 cascade. |
| Name | CBR-470-1 |
|---|
| Description | CBR-470-1 is an inhibitor of the glycolytic enzyme phosphoglycerate kinase 1 (PGK1). CBR-470-1 is also a non-covalent Nrf2 activator. CBR-470-1 protects SH-SY5Y neuronal cells against MPP+-induced cytotoxicity through activation of the Keap1-Nrf2 cascade. |
|---|
| Molecular Formula | C14H20ClNO4S2 |
|---|---|
| Molecular Weight | 365.90 |
| InChIKey | NFEQFEDSWINARK-KBPBESRZSA-N |
| SMILES | CC(C)CNC1CS(=O)(=O)CC1S(=O)(=O)c1ccc(Cl)cc1 |