4-Acetamino-5-Chloro-2-Methoxyl Benzoic Acid
Modify Date: 2025-08-25 10:49:43
4-Acetamino-5-Chloro-2-Methoxyl Benzoic Acid structure
|
Common Name | 4-Acetamino-5-Chloro-2-Methoxyl Benzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 24201-13-6 | Molecular Weight | 243.64400 | |
| Density | 1.424 | Boiling Point | 454.615ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO4 | Melting Point | 188ºC | |
| MSDS | N/A | Flash Point | 228.743ºC | |
| Name | 4-(Acetylamino)-5-chloro-2-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424 |
|---|---|
| Boiling Point | 454.615ºC at 760 mmHg |
| Melting Point | 188ºC |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.64400 |
| Flash Point | 228.743ºC |
| Exact Mass | 243.03000 |
| PSA | 75.63000 |
| LogP | 2.07820 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | GOXCIWMHHSVOKW-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(C)=O)c(Cl)cc1C(=O)O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
|
~85%
4-Acetamino-5-C... CAS#:24201-13-6 |
| Literature: Institute of Medicinal Molecular Design, Inc. Patent: EP1352650 A1, 2003 ; |
CAS#:55-21-0
CAS#:7206-70-4
CAS#:70181-03-2
CAS#:4516-32-9| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-acetamido-5-chloro-2-methoxybenzoic acid |