4-Benzyloxy-2-nitrotoluene structure
|
Common Name | 4-Benzyloxy-2-nitrotoluene | ||
|---|---|---|---|---|
| CAS Number | 24239-67-6 | Molecular Weight | 243.25800 | |
| Density | 1.202g/cm3 | Boiling Point | 389.3ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | 60-62ºC | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 4-Benzyloxy-2-nitrotoluene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 389.3ºC at 760 mmHg |
| Melting Point | 60-62ºC |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.25800 |
| Flash Point | 169.7ºC |
| Exact Mass | 243.09000 |
| PSA | 55.05000 |
| LogP | 4.00540 |
| Vapour Pressure | 6.47E-06mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | DGMVXGHRFDVQHC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCc2ccccc2)cc1[N+](=O)[O-] |
| Risk Phrases | 20/21/22 |
|---|---|
| Safety Phrases | 24/25-36/37 |
| HS Code | 2909309090 |
|
~99%
4-Benzyloxy-2-n... CAS#:24239-67-6 |
| Literature: LAUTENS, Mark; FANG, Yuanqing Patent: WO2006/47888 A1, 2006 ; Location in patent: Page/Page column 82-83 ; |
|
~95%
4-Benzyloxy-2-n... CAS#:24239-67-6 |
| Literature: Ohkubo, Mitsuru; Nishimura, Teruyuki; Jona, Hideki; Honma, Teruki; Morishima, Hajime Tetrahedron, 1996 , vol. 52, # 24 p. 8099 - 8112 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00100651 |
| 1-methyl-2-nitro-4-phenylmethoxybenzene |