CI Direct Brown 2 structure
|
Common Name | CI Direct Brown 2 | ||
|---|---|---|---|---|
| CAS Number | 2429-82-5 | Molecular Weight | 627.535 | |
| Density | 1.54g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C29H19N5Na2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CI Direct Brown 2CI Direct Brown 2 is a direct dye that is soluble in water and ionizable to form colored anions can directly dye the cellulose fibers or protein fibers without the action of the mordant. |
| Name | direct fast brown m |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Molecular Formula | C29H19N5Na2O7S |
| Molecular Weight | 627.535 |
| Exact Mass | 627.080078 |
| PSA | 221.63000 |
| LogP | 7.26060 |
| Index of Refraction | 1.733 |
| InChIKey | CXAVOCVLMJULES-UHFFFAOYSA-L |
| SMILES | Nc1ccc2cc(S(=O)(=O)[O-])c(N=Nc3ccc(-c4ccc(N=Nc5ccc(O)c(C(=O)[O-])c5)cc4)cc3)c(O)c2c1.[Na+].[Na+] |
| RTECS | DM2800435 |
|---|
| mahoganyembl |
| brownm |
| benzobrownmc |
| Disodium 5-[(E)-{4'-[(E)-(7-amino-1-hydroxy-3-sulfonato-2-naphthyl)diazenyl]biphenyl-4-yl}diazenyl]-2-hydroxybenzoate |
| Benzoic acid, 5-[(E)-2-[4'-[(E)-2-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-2-hydroxy-, sodium salt (1:2) |
| diazolbrownm |
| EINECS 219-391-6 |
| benzoic acid, 5-[(E)-[4'-[(E)-(7-amino-1-hydroxy-3-sulfo-2-naphthalenyl)azo][1,1'-biphenyl]-4-yl]azo]-2-hydroxy-, disodium salt |
| Direct Brown M |
| disodium 5-[(E)-{4'-[(E)-(7-amino-1-hydroxy-3-sulfonatonaphthalen-2-yl)diazenyl]biphenyl-4-yl}diazenyl]-2-hydroxybenzoate |
| benzobrownm |
| unionbrowndr |
| azinebrownm |
| Disodium 5-[(E)-{4'-[(E)-(7-amino-1-hydroxy-3-sulfonato-2-naphthyl)diazenyl]-4-biphenylyl}diazenyl]-2-hydroxybenzoate |
| diazobrownmc |