Benzoic acid,4-methoxy-, (4-methoxyphenyl)methyl ester structure
|
Common Name | Benzoic acid,4-methoxy-, (4-methoxyphenyl)methyl ester | ||
|---|---|---|---|---|
| CAS Number | 24318-43-2 | Molecular Weight | 272.29600 | |
| Density | 1.153g/cm3 | Boiling Point | 413.2ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.1ºC | |
| Name | (4-methoxyphenyl)methyl 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 183.1ºC |
| Exact Mass | 272.10500 |
| PSA | 44.76000 |
| LogP | 3.06080 |
| Vapour Pressure | 4.89E-07mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | PUXJRQHDLYGOCY-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)c2ccc(OC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-dimethoxybenzyl benzoate |
| p-Methoxybenzyl p-anisate |
| 4-methoxylbenzyl 4-methoxylbenzoate |
| EINECS 246-159-1 |