4-Methoxybenzyl 2,2,2-trichloroethanimidate structure
|
Common Name | 4-Methoxybenzyl 2,2,2-trichloroethanimidate | ||
|---|---|---|---|---|
| CAS Number | 89238-99-3 | Molecular Weight | 282.551 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 348.1±0.0 °C at 760 mmHg | |
| Molecular Formula | C10H10Cl3NO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 133.5±30.1 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 4-Methoxybenzyl 2,2,2-TrichloroacetiMidate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 348.1±0.0 °C at 760 mmHg |
| Molecular Formula | C10H10Cl3NO2 |
| Molecular Weight | 282.551 |
| Flash Point | 133.5±30.1 °C |
| Exact Mass | 280.977722 |
| PSA | 42.31000 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | TYHGKLBJBHACOI-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=N)C(Cl)(Cl)Cl)cc1 |
| Storage condition | Refrigerator |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335-H411 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | 20/21/22-36/37/38-51/53 |
| Safety Phrases | 26-61 |
| RIDADR | UN 3082 9/PG 3 |
| HS Code | 2925290090 |
|
~98%
4-Methoxybenzyl... CAS#:89238-99-3 |
| Literature: Tokuyama, Hidetoshi; Okano, Kentaro; Fujiwara, Hideto; Noji, Toshiharu; Fukuyama, Tohru Chemistry - An Asian Journal, 2011 , vol. 6, # 2 p. 560 - 572 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Tetrahedron 63 , 3682, (2007)
|
|
|
Tetrahedron Lett. 29 , 4139, (1988)
|
|
|
Tetrahedron Lett. 37 , 1482, (1996)
|
| MFCD00134547 |
| 4-Methoxybenzyl 2,2,2-trichloroethanimidoate |
| (4-methoxyphenyl)methyl 2,2,2-trichloroethanimidate |
| Ethanimidic acid, 2,2,2-trichloro-, (4-methoxyphenyl)methyl ester |
| 4-Methoxybenzyl 2,2,2-trichloroethanimidate |