3,5-Cyclohexadiene-1,2-dione,3,4,5,6-tetrabromo- structure
|
Common Name | 3,5-Cyclohexadiene-1,2-dione,3,4,5,6-tetrabromo- | ||
|---|---|---|---|---|
| CAS Number | 2435-54-3 | Molecular Weight | 423.67900 | |
| Density | 3.127g/cm3 | Boiling Point | 197.9ºC at 760 mmHg | |
| Molecular Formula | C6Br4O2 | Melting Point | 148-151ºC(lit.) | |
| MSDS | N/A | Flash Point | 37.7ºC | |
| Name | 3,4,5,6-tetrabromocyclohexa-3,5-diene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 3.127g/cm3 |
|---|---|
| Boiling Point | 197.9ºC at 760 mmHg |
| Melting Point | 148-151ºC(lit.) |
| Molecular Formula | C6Br4O2 |
| Molecular Weight | 423.67900 |
| Flash Point | 37.7ºC |
| Exact Mass | 419.66300 |
| PSA | 34.14000 |
| LogP | 3.14100 |
| Vapour Pressure | 0.369mmHg at 25°C |
| Index of Refraction | 1.806 |
| InChIKey | DXKHBLYQXDEINJ-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)C(Br)=C(Br)C(Br)=C1Br |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Tetrabromo-1,2-benzoquinone |
| Tetrabromo-o-benzoquinone |
| o-Bromanil |
| EINECS 219-426-5 |
| Tetrabromoorthobenzoquinone |
| 3,4,5,6-tetrabromo-1,2-benzoquinone |
| 3,4,5,6-tetrabromo-o-benzoquinone |