1,2-Benzenediol,3,4,5,6-tetrabromo structure
|
Common Name | 1,2-Benzenediol,3,4,5,6-tetrabromo | ||
|---|---|---|---|---|
| CAS Number | 488-47-1 | Molecular Weight | 425.69500 | |
| Density | 2.818g/cm3 | Boiling Point | 339.3ºC at 760mmHg | |
| Molecular Formula | C6H2Br4O2 | Melting Point | 189-193ºC | |
| MSDS | Chinese USA | Flash Point | 159ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tetrabromocatechol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.818g/cm3 |
|---|---|
| Boiling Point | 339.3ºC at 760mmHg |
| Melting Point | 189-193ºC |
| Molecular Formula | C6H2Br4O2 |
| Molecular Weight | 425.69500 |
| Flash Point | 159ºC |
| Exact Mass | 421.67900 |
| PSA | 40.46000 |
| LogP | 4.14780 |
| Vapour Pressure | 4.73E-05mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | OAUWOBSDSJNJQP-UHFFFAOYSA-N |
| SMILES | Oc1c(O)c(Br)c(Br)c(Br)c1Br |
| Water Solubility | It is partly miscible with water. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | UX2430000 |
| HS Code | 2908199090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|
Name: Inhibition of human CA2 using 4NPA as substrate for 3 mins by Lineweaver burk plot an...
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL2045715
|
|
Name: Inhibition of human CA4 using 4NPA as substrate for 3 mins by Lineweaver burk plot an...
Source: ChEMBL
Target: Carbonic anhydrase 4
External Id: CHEMBL2045823
|
|
Name: Cytotoxicity against human HCT116 cells after 96 hrs by MTT assay
Source: ChEMBL
Target: HCT-116
External Id: CHEMBL965891
|
|
Name: Noncompetitive inhibition of human CA1 using 4NPA as substrate for 3 mins by Lineweav...
Source: ChEMBL
Target: Carbonic anhydrase 1
External Id: CHEMBL2045714
|
|
Name: Inhibition of human CA6 using 4NPA as substrate for 3 mins by Lineweaver burk plot an...
Source: ChEMBL
Target: Carbonic anhydrase 6
External Id: CHEMBL2045824
|
|
Name: Cytotoxicity against human DLD1 cells after 96 hrs by MTT assay
Source: ChEMBL
Target: DLD-1
External Id: CHEMBL965890
|
| 3,4,5,6-tetrabromobenzene-1,2-diol |
| tetrabromo-pyrocatecho |
| tetrabromo-1.2-dihydroxybenzene |
| TETRABROMOPYROCATECHOL |
| Tetrabromobenzene-1,2-diol |
| 1,2-dihydroxytetrabromobenzene |
| EINECS 207-678-9 |
| 3,4,5,6-tetrabromocatechol |
| 3,4,5,6-tetrabromo-2-benzenediol |
| 3,4,5,6-tetrabromo-1,2-benzenediol |
| MFCD00002189 |