2H-Indene-2,2-dicarboxylicacid, 1,3-dihydro- structure
|
Common Name | 2H-Indene-2,2-dicarboxylicacid, 1,3-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 2437-08-3 | Molecular Weight | 206.19500 | |
| Density | 1.457g/cm3 | Boiling Point | 456.8ºC at 760mmHg | |
| Molecular Formula | C11H10O4 | Melting Point | 191-195ºC (dec.)(lit.) | |
| MSDS | USA | Flash Point | 244.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,3-dihydroindene-2,2-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.457g/cm3 |
|---|---|
| Boiling Point | 456.8ºC at 760mmHg |
| Melting Point | 191-195ºC (dec.)(lit.) |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.19500 |
| Flash Point | 244.2ºC |
| Exact Mass | 206.05800 |
| PSA | 74.60000 |
| LogP | 0.94080 |
| Vapour Pressure | 3.87E-09mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | RYGAENQWIQPFAI-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(C(=O)O)Cc2ccccc2C1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2917399090 |
|
~92%
2H-Indene-2,2-d... CAS#:2437-08-3 |
| Literature: Mueller, Paul; Miao, Zhongshan Helvetica Chimica Acta, 1994 , vol. 77, p. 2051 - 2059 |
|
~%
2H-Indene-2,2-d... CAS#:2437-08-3 |
| Literature: Merrell Pharmaceuticals Inc. Patent: US5840729 A1, 1998 ; US 5840729 A |
|
~%
2H-Indene-2,2-d... CAS#:2437-08-3 |
| Literature: Merrell Dow Pharmaceuticals Inc. Patent: US5047534 A1, 1991 ; |
|
~%
2H-Indene-2,2-d... CAS#:2437-08-3 |
| Literature: Tomiyama; Wakabayashi; Yokota Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1988 - 1996 |
|
~%
2H-Indene-2,2-d... CAS#:2437-08-3 |
| Literature: Perkin; Revay Journal of the Chemical Society, 1894 , vol. 65, p. 232 Full Text Show Details Perkin Journal of the Chemical Society, 1888 , vol. 53, p. 7 Full Text Show Details Baeyer; Perkin Chemische Berichte, 1884 , vol. 17, p. 124 |
| Precursor 5 | |
|---|---|
| DownStream 5 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-dihydro-2h-indene-2,2-dicarboxylic acid |
| Indan-2,2-dicarboxylic acid |
| 1,2-dihydro-1H-indene-1,1-dicarboxylic acid |
| Hydrinden-dicarbonsaeure-(2.2) |
| 2,2-indandicarboxylic acid |
| Indan-2,2-dicarbonsaeure |
| indane-2,2-dicarboxylic acid |
| MFCD00085096 |