Benzenesulfonamide,3,4-dichloro-N-(4-nitrophenyl)- structure
|
Common Name | Benzenesulfonamide,3,4-dichloro-N-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2438-99-5 | Molecular Weight | 347.17400 | |
| Density | 1.62g/cm3 | Boiling Point | 517ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.5ºC | |
| Name | 3,4-dichloro-N-(4-nitrophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 517ºC at 760 mmHg |
| Molecular Formula | C12H8Cl2N2O4S |
| Molecular Weight | 347.17400 |
| Flash Point | 266.5ºC |
| Exact Mass | 345.95800 |
| PSA | 100.37000 |
| LogP | 5.37940 |
| Vapour Pressure | 8.56E-11mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | HAYZJERLLURJEF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
|
~%
Benzenesulfonam... CAS#:2438-99-5 |
| Literature: Roehm and Haas Co. Patent: US2402623 , 1943 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-Dichloro-4'-nitrobenzenesulfonanilide |
| 3,4-Dichlor-benzolsulfonsaeure-(4-nitro-anilid) |
| HE 761 |
| Benzenesulfonanilide,4-dichloro-4'-nitro |
| 3,4-dichloro-benzenesulfonic acid-(4-nitro-anilide) |