2-(4,4,5,5,6,6,6-Heptafluorohexyl)malonic acid structure
|
Common Name | 2-(4,4,5,5,6,6,6-Heptafluorohexyl)malonic acid | ||
|---|---|---|---|---|
| CAS Number | 244022-64-8 | Molecular Weight | 314.15400 | |
| Density | 1.532g/cm3 | Boiling Point | 319ºC at 760 mmHg | |
| Molecular Formula | C9H9F7O4 | Melting Point | 114-115ºC | |
| MSDS | N/A | Flash Point | 146.8ºC | |
| Name | 2-(4,4,5,5,6,6,6-Heptafluorohexyl)malonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 319ºC at 760 mmHg |
| Melting Point | 114-115ºC |
| Molecular Formula | C9H9F7O4 |
| Molecular Weight | 314.15400 |
| Flash Point | 146.8ºC |
| Exact Mass | 314.03900 |
| PSA | 74.60000 |
| LogP | 2.77500 |
| Vapour Pressure | 7.29E-05mmHg at 25°C |
| Index of Refraction | 1.383 |
| InChIKey | CGCPPBXAEGMASM-UHFFFAOYSA-N |
| SMILES | O=C(O)C(CCCC(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2917190090 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(4,4,5,5,6,6,6-heptafluorohexyl)propanedioic acid |