2,6-di-tert-butylhydroquinone structure
|
Common Name | 2,6-di-tert-butylhydroquinone | ||
|---|---|---|---|---|
| CAS Number | 2444-28-2 | Molecular Weight | 222.32300 | |
| Density | 1.012 g/cm3 | Boiling Point | 313.3ºC at 760 mmHg | |
| Molecular Formula | C14H22O2 | Melting Point | 101.5-102.5°C (lit.) | |
| MSDS | N/A | Flash Point | 138.8ºC | |
| Name | 2,6-ditert-butylbenzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.012 g/cm3 |
|---|---|
| Boiling Point | 313.3ºC at 760 mmHg |
| Melting Point | 101.5-102.5°C (lit.) |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.32300 |
| Flash Point | 138.8ºC |
| Exact Mass | 222.16200 |
| PSA | 40.46000 |
| LogP | 3.69280 |
| Vapour Pressure | 0.000271mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | JFGVTUJBHHZRAB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(O)cc(C(C)(C)C)c1O |
| HS Code | 2907299090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 1,4-Benzenediol,2,6-bis(1,1-dimethylethyl) |
| 2,5-ditertbutylhydroquinone |
| 2,6-di-tert-butyl-1,4-dihydroxybenzene |
| 2,6-di-tert-butyl-hydroquinone |
| 2,6-di-tert-butyl-4-hydroxyphenol |
| 2,6-di(tert-butyl)-1,4-hydroquinone |