2-(10-Bromodecyl)isoindoline-1,3-dione structure
|
Common Name | 2-(10-Bromodecyl)isoindoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 24566-80-1 | Molecular Weight | 366.29300 | |
| Density | 1.283g/cm3 | Boiling Point | 451.4ºC at 760 mmHg | |
| Molecular Formula | C18H24BrNO2 | Melting Point | 58ºC | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | N-(10-Bromodecyl)phthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 451.4ºC at 760 mmHg |
| Melting Point | 58ºC |
| Molecular Formula | C18H24BrNO2 |
| Molecular Weight | 366.29300 |
| Flash Point | 226.8ºC |
| Exact Mass | 365.09900 |
| PSA | 37.38000 |
| LogP | 4.73620 |
| Vapour Pressure | 2.43E-08mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | LJFIOTMXPRSHSB-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCCCBr |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2925190090 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(10-bromodecyl)isoindole-1,3-dione |
| MFCD00060521 |