1H-Pyrazole,3,4-diphenyl- structure
|
Common Name | 1H-Pyrazole,3,4-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 24567-08-6 | Molecular Weight | 220.26900 | |
| Density | 1.149g/cm3 | Boiling Point | 396.9ºC at 760mmHg | |
| Molecular Formula | C15H12N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.8ºC | |
| Name | 4,5-diphenyl-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 396.9ºC at 760mmHg |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.26900 |
| Flash Point | 180.8ºC |
| Exact Mass | 220.10000 |
| PSA | 28.68000 |
| LogP | 3.74370 |
| Vapour Pressure | 3.79E-06mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | MQWYZELNDPRANJ-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2cn[nH]c2-c2ccccc2)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4-diphenylpyrazole |
| Pyrazole,4-diphenyl |
| 3,4-diphenyl-1(2)H-pyrazole |
| 3,4-Diphenyl-pyrazol |
| 3,4-diphenyl-1H-pyrazole |
| Pyrazole,3,4-diphenyl |
| 1H-Pyrazole,4-diphenyl |
| 3,4-Diphenyl-1(2)H-pyrazol |