3-Quinolinecarbonitrile, 7-chloro-4-hydroxy- structure
|
Common Name | 3-Quinolinecarbonitrile, 7-chloro-4-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 2458-23-3 | Molecular Weight | 204.61200 | |
| Density | 1.46g/cm3 | Boiling Point | 338.5ºC at 760 mmHg | |
| Molecular Formula | C10H5ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | 7-Chloro-4-oxo-1,4-dihydro-3-quinolinecarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 338.5ºC at 760 mmHg |
| Molecular Formula | C10H5ClN2O |
| Molecular Weight | 204.61200 |
| Flash Point | 158.5ºC |
| Exact Mass | 204.00900 |
| PSA | 56.65000 |
| LogP | 2.05318 |
| Vapour Pressure | 9.81E-05mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | AWSDUPVFXCHALA-UHFFFAOYSA-N |
| SMILES | N#Cc1c[nH]c2cc(Cl)ccc2c1=O |
| HS Code | 2933499090 |
|---|
|
~%
3-Quinolinecarb... CAS#:2458-23-3 |
| Literature: Snyder; Jones Journal of the American Chemical Society, 1946 , vol. 68, p. 1253 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Chlor-4-hydroxy-chinolin-3-carbonitril |
| 7-Chlor-4-hydroxyamino-chinolin-1-oxid |
| 4-Quinolinamine,7-chloro-N-hydroxy-,1-oxide |
| 7-chloro-4-hydroxy-quinoline-3-carbonitrile |
| 7-Chlor-4-hydroxy-3-cyan-chinolin |