O-benzyl-L-histidine bis(toluene-p-sulphonate) structure
|
Common Name | O-benzyl-L-histidine bis(toluene-p-sulphonate) | ||
|---|---|---|---|---|
| CAS Number | 24593-59-7 | Molecular Weight | 589.68000 | |
| Density | N/A | Boiling Point | 856.1ºC at 760mmHg | |
| Molecular Formula | C27H31N3O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of O-benzyl-L-histidine bis(toluene-p-sulphonate)L-Histidine benzyl ester bistosylate could play a role in the activation of HutP (an RNA-binding protein)[1]. |
| Name | benzyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | L-Histidine benzyl ester bistosylate could play a role in the activation of HutP (an RNA-binding protein)[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 856.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C27H31N3O8S2 |
| Molecular Weight | 589.68000 |
| Exact Mass | 589.15500 |
| PSA | 206.50000 |
| LogP | 6.36820 |
| Vapour Pressure | 3.24E-31mmHg at 25°C |
| InChIKey | FQHRMEOHSXSJBX-LTCKWSDVSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.NC(Cc1cnc[nH]1)C(=O)OCc1ccccc1 |
| Storage condition | −20°C |
|
~91%
O-benzyl-L-hist... CAS#:24593-59-7 |
| Literature: Jones, J.H.; Wood, M.E. Synthetic Communications, 1986 , vol. 16, # l2 p. 1515 - 1516 |
|
~80%
O-benzyl-L-hist... CAS#:24593-59-7 |
| Literature: Thaqi, Ali; Scott, Janet L.; Gilbert, Jayne; Sakoff, Jennette A.; McCluskey, Adam European Journal of Medicinal Chemistry, 2010 , vol. 45, # 5 p. 1717 - 1723 |
|
~%
O-benzyl-L-hist... CAS#:24593-59-7 |
| Literature: Akabori et al. Bulletin of the Chemical Society of Japan, 1958 , vol. 31, p. 784 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| histidine benzyl ester di-p-toluenesulfonic acid salt |
| histidine benzyl ester di-p-toluenesulfonate salt |
| EINECS 246-334-2 |
| L-histidine benzyl ester,bis-(toluene-4-sulfonate) |
| L-histidine benzyl ester di-para-toluene sulfonate |
| (S)-Benzyl 2-amino-3-(1H-imidazol-4-yl)propanoate bis(4-methylbenzenesulfonate) |
| O-benzyl-L-histidine bis(toluene-p-sulphonate) |
| L-Histidin-benzylester,Bis-(toluol-4-sulfonat) |
| L-histidine benzyl ester di-p-toluenesulphonate |