6-Nitro-2,3-dihydro-1H-inden-1-one structure
|
Common Name | 6-Nitro-2,3-dihydro-1H-inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 24623-24-3 | Molecular Weight | 177.157 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 332.0±31.0 °C at 760 mmHg | |
| Molecular Formula | C9H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8±17.6 °C | |
| Name | 6-nitro-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 332.0±31.0 °C at 760 mmHg |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.157 |
| Flash Point | 169.8±17.6 °C |
| Exact Mass | 177.042587 |
| PSA | 62.89000 |
| LogP | 1.92 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | MLRACZPAMDFORH-UHFFFAOYSA-N |
| SMILES | O=C1CCc2ccc([N+](=O)[O-])cc21 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39-45-36/37 |
| HS Code | 2914700090 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-Nitro-2,3-dihydro-1H-inden-1-one |
| 2,3-Dihydro-6-nitro-1-oxo-1H-indene |
| 4-nitro-indan-1-one |
| 6-nitro-1-indatone |
| 6-nitroindan-l-one |
| 6-Nitro-2,3-dihydro-1H-inden-1-on |
| MFCD06656903 |
| 6-Nitro-1-indanone |
| 2,3-Dihydro-6-nitro-1H-inden-1-one |
| 1H-Inden-1-one, 2,3-dihydro-6-nitro- |
| EINECS 246-366-7 |
| 6-nitroindan-1-one |
| 2,3-diidro-6-nitro-1H-indene-1-one |
| 6-NITROINDANONE |