Boc-Orn(Z)-OH structure
|
Common Name | Boc-Orn(Z)-OH | ||
|---|---|---|---|---|
| CAS Number | 2480-93-5 | Molecular Weight | 366.409 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 579.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H26N2O6 | Melting Point | 98 to 104ºC | |
| MSDS | Chinese USA | Flash Point | 304.0±30.1 °C | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 579.1±50.0 °C at 760 mmHg |
| Melting Point | 98 to 104ºC |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.409 |
| Flash Point | 304.0±30.1 °C |
| Exact Mass | 366.179077 |
| PSA | 113.96000 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | QYYCZJUFHDLLOJ-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCCNC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~99%
Boc-Orn(Z)-OH CAS#:2480-93-5 |
| Literature: Feldman Tetrahedron Letters, 1991 , vol. 32, # 7 p. 875 - 878 |
|
~%
Boc-Orn(Z)-OH CAS#:2480-93-5 |
| Literature: Chemical Communications, , # 8 p. 717 - 718 |
|
~%
Boc-Orn(Z)-OH CAS#:2480-93-5 |
| Literature: Chemical Communications, , # 8 p. 717 - 718 |
|
~%
Boc-Orn(Z)-OH CAS#:2480-93-5 |
| Literature: Journal of the Chemical Society [Section] C: Organic, , p. 2632 - 2636 |
|
~%
Boc-Orn(Z)-OH CAS#:2480-93-5 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. 38, p. 50 - 56 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-Orn(Z)-OH |
| Boc-Orn(Cbz)-OH |
| Nalpha-(Tert-Butoxycarbonyl)-Ndelta-Carbobenzoxy-L-Ornithine |
| Nα-Boc-Nδ-Cbz-L-ornithine |
| (2S)-5-{[(Benzyloxy)carbonyl]amino}-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)pentanoic acid |
| N-[(Benzyloxy)carbonyl]-N-(tert-butoxycarbonyl)-L-ornithine |
| L-Ornithine, N-[(1,1-dimethylethoxy)carbonyl]-N-[(phenylmethoxy)carbonyl]- |
| MFCD00038259 |
| Nα-(tert-Butoxycarbonyl)-Ndelta-carbobenzoxy-L-ornithine |
| (S)-5-(((Benzyloxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)pentanoic acid |
| Nα-(tert-Butoxycarbonyl)-Nδ-carbobenzoxy-L-ornithine |
| Boc-ornithine(Cbz)-OH |
| N-[(Benzyloxy)carbonyl]-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-ornithine |
| (S)-N5-(benzyloxycarbonyl)-N2-(tert-butyloxycarbonyl)-ornithine |
| N-tert-Butoxycarbonyl-N'-benzyloxycarbonyl-L-ornithine |