gallic acid isoamyl ester structure
|
Common Name | gallic acid isoamyl ester | ||
|---|---|---|---|---|
| CAS Number | 2486-02-4 | Molecular Weight | 240.25200 | |
| Density | 1.271g/cm3 | Boiling Point | 450.9ºC at 760mmHg | |
| Molecular Formula | C12H16O5 | Melting Point | 142ºC | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 3-methylbutyl 3,4,5-trihydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 450.9ºC at 760mmHg |
| Melting Point | 142ºC |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25200 |
| Flash Point | 174.3ºC |
| Exact Mass | 240.10000 |
| PSA | 86.99000 |
| LogP | 2.00630 |
| Vapour Pressure | 9.52E-09mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | YBMTWYWCLVMFFD-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)c1cc(O)c(O)c(O)c1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2918290000 |
|
~%
gallic acid iso... CAS#:2486-02-4 |
| Literature: Ernst; Zwenger Justus Liebigs Annalen der Chemie, 1871 , vol. 159, p. 33 Full Text Show Details Mc Kenzie; Mueller Journal of the Chemical Society, 1909 , vol. 95, p. 545 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Gallussaeure-isopentylester |
| Gallussaeureisoamylester |
| Gallic Acid Isoamyl Ester |
| Isopentyl gallate |
| EINECS 219-626-2 |
| isoamyl gallate |
| 3,4,5-Trihydroxy-benzoesaeure-isopentylester |
| 3,4,5-trihydroxy-benzoic acid isopentyl ester |