ABBV-CLS-484 structure
|
Common Name | ABBV-CLS-484 | ||
|---|---|---|---|---|
| CAS Number | 2489404-97-7 | Molecular Weight | 385.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24FN3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ABBV-CLS-484ABBV-CLS-484 is a potent PTPN1 or PTPN2 inhibitor with a sub-nanomolar activity. |
| Name | ABBV-CLS-484 |
|---|
| Description | ABBV-CLS-484 is a potent PTPN1 or PTPN2 inhibitor with a sub-nanomolar activity. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H24FN3O4S |
|---|---|
| Molecular Weight | 385.45 |
| InChIKey | DVFCRTGTEXUFIN-GFCCVEGCSA-N |
| SMILES | CC(C)CCNC1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| Storage condition | 2-8°C |