2,3-BIS-(2?ˉ-PYRIDYL)-5,6-DIHYDROPYRAZINE structure
|
Common Name | 2,3-BIS-(2?ˉ-PYRIDYL)-5,6-DIHYDROPYRAZINE | ||
|---|---|---|---|---|
| CAS Number | 25005-95-2 | Molecular Weight | 236.27200 | |
| Density | 1.23g/cm3 | Boiling Point | 429.9ºC at 760mmHg | |
| Molecular Formula | C14H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | 5,6-dipyridin-2-yl-2,3-dihydropyrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 429.9ºC at 760mmHg |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.27200 |
| Flash Point | 213.8ºC |
| Exact Mass | 236.10600 |
| PSA | 50.50000 |
| LogP | 0.63980 |
| Vapour Pressure | 3.39E-07mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | QGRHYAPZGPPUEM-UHFFFAOYSA-N |
| SMILES | c1ccc(C2=NCCN=C2c2ccccn2)nc1 |
| HS Code | 2933990090 |
|---|
|
~%
2,3-BIS-(2?ˉ-PY... CAS#:25005-95-2 |
| Literature: Goodwin; Lions Journal of the American Chemical Society, 1959 , vol. 81, p. 6415,6420 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrazine,2,3-dihydro-5,6-di-2-pyridinyl |
| EINECS 246-560-1 |
| 2,3,4-TRIHYDROXYBENZYLHYDRAZINE |