2,3-BIS(2-PYRIDYL)PYRAZINE structure
|
Common Name | 2,3-BIS(2-PYRIDYL)PYRAZINE | ||
|---|---|---|---|---|
| CAS Number | 25005-96-3 | Molecular Weight | 234.25600 | |
| Density | 1.214g/cm3 | Boiling Point | 361.6ºC at 760 mmHg | |
| Molecular Formula | C14H10N4 | Melting Point | 168-170ºC(lit.) | |
| MSDS | N/A | Flash Point | 159.5ºC | |
| Name | 2,3-dipyridin-2-ylpyrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 361.6ºC at 760 mmHg |
| Melting Point | 168-170ºC(lit.) |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.25600 |
| Flash Point | 159.5ºC |
| Exact Mass | 234.09100 |
| PSA | 51.56000 |
| LogP | 2.60060 |
| Vapour Pressure | 4.27E-05mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | WTZDTUCKEBDJIM-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nccnc2-c2ccccn2)nc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| HS Code | 2933990090 |
|
~%
2,3-BIS(2-PYRID... CAS#:25005-96-3 |
| Literature: Goodwin; Lions Journal of the American Chemical Society, 1959 , vol. 81, p. 6415,6420 |
|
~%
2,3-BIS(2-PYRID... CAS#:25005-96-3 |
| Literature: Goodwin; Lions Journal of the American Chemical Society, 1959 , vol. 81, p. 6415,6420 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00010434 |
| 2,3-di-pyridin-2-ylpyrazine |
| 2,3-Bis(2-pyridyl)pyrazine |
| 2,3-bis-(pyridin-2-yl)-pyrazine |
| 2,3-bis(pyridyl)pyrazine |
| 2,3-di(2-pyridyl)pyrazine |