2-(2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXIN-5-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE structure
|
Common Name | 2-(2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXIN-5-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | ||
|---|---|---|---|---|
| CAS Number | 250726-93-3 | Molecular Weight | 268.13700 | |
| Density | 1.21g/cm3 | Boiling Point | 372.9ºC at 760mmHg | |
| Molecular Formula | C12H17BO4S | Melting Point | 93ºC | |
| MSDS | N/A | Flash Point | 179.3ºC | |
| Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 372.9ºC at 760mmHg |
| Melting Point | 93ºC |
| Molecular Formula | C12H17BO4S |
| Molecular Weight | 268.13700 |
| Flash Point | 179.3ºC |
| Exact Mass | 268.09400 |
| PSA | 65.16000 |
| LogP | 1.81850 |
| Vapour Pressure | 2E-05mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | HRLHWIMNIQOHRF-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2scc3c2OCCO3)OC1(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2934999090 |
|
~86%
2-(2,3-DIHYDROT... CAS#:250726-93-3 |
| Literature: Tetrahedron, , vol. 69, # 2 p. 861 - 866 |
|
~71%
2-(2,3-DIHYDROT... CAS#:250726-93-3 |
| Literature: Tetrahedron, , vol. 55, # 40 p. 11745 - 11754 |
|
~%
2-(2,3-DIHYDROT... CAS#:250726-93-3 |
| Literature: Journal of Organic Chemistry, , vol. 77, # 20 p. 8851 - 8863 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxoborolane |
| 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-4,4,5,5-tetramethyl-2-thiophen-2-yl-1,3,2-dioxaborolane |
| 5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-2,3-dihydrothieno-[3,4-b][1,4]dioxin |
| 3,4-ethylenedioxythiophene 4,4',5,5'-tetramethyl-1,3,2-dioxaboronic ester |
| 5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |