Isopropoxyboronic acid pinacol ester structure
|
Common Name | Isopropoxyboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 61676-62-8 | Molecular Weight | 186.056 | |
| Density | 0.912 | Boiling Point | 73 ºC (15 mmHg) | |
| Molecular Formula | C9H19BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 43 ºC | |
| Name | 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.912 |
|---|---|
| Boiling Point | 73 ºC (15 mmHg) |
| Molecular Formula | C9H19BO3 |
| Molecular Weight | 186.056 |
| Flash Point | 43 ºC |
| Exact Mass | 186.142731 |
| PSA | 27.69000 |
| LogP | 2.00030 |
| Vapour Pressure | 4.9±0.3 mmHg at 25°C |
| Index of Refraction | 1.409 |
| InChIKey | MRWWWZLJWNIEEJ-UHFFFAOYSA-N |
| SMILES | CC(C)OB1OC(C)(C)C(C)(C)O1 |
| Storage condition | 0-6°C |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S16-S26-S36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2934999090 |
|
~92%
Isopropoxyboron... CAS#:61676-62-8 |
| Literature: Linshoeft, Julian; Heinrich, Annika C. J.; Segler, Stephan A. W.; Gates, Paul J.; Staubitz, Anne Organic Letters, 2012 , vol. 14, # 22 p. 5644 - 5647 |
|
~85%
Isopropoxyboron... CAS#:61676-62-8 |
| Literature: Lin, Qiyan; Meloni, David; Pan, Yongchun; Xia, Michael; Rodgers, James; Shepard, Stacey; Li, Mei; Galya, Laurine; Metcalf, Brian; Yue, Tai-N; Liu, Pingli; Zhou, Jiacheng Organic Letters, 2009 , vol. 11, # 9 p. 1999 - 2002 |
|
~%
Isopropoxyboron... CAS#:61676-62-8 |
| Literature: Journal of the Chemical Society, , p. 3819 - 3821 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| MFCD00192241 |
| 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(1-methylethoxy)- |
| 4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane |
| Isopropoxyboronic acid pinacol ester |