9,10-Anthracenedione,2-[[4-(dimethylamino)phenyl]methyl]-1,4-dihydroxy- structure
|
Common Name | 9,10-Anthracenedione,2-[[4-(dimethylamino)phenyl]methyl]-1,4-dihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 25158-10-5 | Molecular Weight | 373.40100 | |
| Density | 1.366g/cm3 | Boiling Point | 613.3ºC at 760mmHg | |
| Molecular Formula | C23H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.7ºC | |
| Name | 2-[[4-(dimethylamino)phenyl]methyl]-1,4-dihydroxyanthracene-9,10-dione |
|---|
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 613.3ºC at 760mmHg |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.40100 |
| Flash Point | 324.7ºC |
| Exact Mass | 373.13100 |
| PSA | 77.84000 |
| LogP | 3.53000 |
| Vapour Pressure | 1.23E-15mmHg at 25°C |
| Index of Refraction | 1.703 |
| InChIKey | XJJGTPWEJSPTIJ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(Cc2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)cc1 |
|
~%
9,10-Anthracene... CAS#:25158-10-5 |
| Literature: Lewis,C.E. et al. Journal of Organic Chemistry, 1970 , vol. 35, # 9 p. 2938 - 2942 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |