1,4-Anthracenedione,2,3-dihydro-9,10-dihydroxy- structure
|
Common Name | 1,4-Anthracenedione,2,3-dihydro-9,10-dihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 17648-03-2 | Molecular Weight | 242.22700 | |
| Density | 1.511g/cm3 | Boiling Point | 575.8ºC at 760mmHg | |
| Molecular Formula | C14H10O4 | Melting Point | 154-157ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 316ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,3-dihydro-9,10-dihydroxy-1,4-anthracenedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 575.8ºC at 760mmHg |
| Melting Point | 154-157ºC(lit.) |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.22700 |
| Flash Point | 316ºC |
| Exact Mass | 242.05800 |
| PSA | 74.60000 |
| LogP | 2.41020 |
| Vapour Pressure | 7.4E-14mmHg at 25°C |
| Index of Refraction | 1.744 |
| InChIKey | FVXPBEUYCCZFJT-UHFFFAOYSA-N |
| SMILES | O=C1CCC(=O)c2c1c(O)c1ccccc1c2O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 24/25-26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914690090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
An investigation of anthraquinone dye biodegradation by immobilized Aspergillus flavus in fluidized bed bioreactor.
Environ. Sci. Pollut. Res. Int. 19(5) , 1728-37, (2012) Biodegradation and biodecolorization of Drimarene blue K(2)RL (anthraquinone) dye by a fungal isolate Aspergillus flavus SA2 was studied in lab-scale immobilized fluidized bed bioreactor (FBR) system.... |
|
|
An HPLC method development for the assessment of degradation products of anthraquinone dye.
Environ. Monit. Assess. 176(1-4) , 597-604, (2011) This paper describes the development of a simple and sensitive method with reduced run time for the estimation of biodegradation product of an anthraquinone dye, Drimarene blue K(2)RL. The chromatogra... |
|
|
Leucoquinizarin as an analytical spectrophotometric and fluorimetric reagent: application to the determination of magnesium in pharmaceutical preparations.
Analyst 111(4) , 429-33, (1986)
|
| Leuco-1,4-dihydroxyanthraquinone |
| 2,3-dihydro-9,10-dihydroxyanthracene-1,4-dione |
| MFCD00012251 |
| 2,3DIHYDRO-1,4-DIHYDROXY-9,10-ANTHRACENEDIONE |
| 9,10-DIHYDROXY-2,3-DIHYDRO-ANTHRACENE-1,4-DIONE |
| 4-Anthracenedione,2,3-dihydro-9,10-dihydroxy-1 |
| 2,3-dihydro-9,10-dihydroxy-4-anthracenedione |
| 1,4,9,10-Anthratetrol |
| 1,4-DIHYDROXY-2,3-DIHYDRO ANTHRAQUINONE |
| Leucoquinizarin |
| 9,10-dihydroxy-2,3-dihydro-1,4-anthraquinone |
| 9,10-Dihydroxy-2,3-dihydro-1,4-anthracenedione |
| EINECS 241-631-3 |
| 2,3-dihydro-9,10-dihydroxyanthracene-1,4-dione <leucoquinizarin> |