Benzeneacetic acid,2-hydroxy-a-phenyl- structure
|
Common Name | Benzeneacetic acid,2-hydroxy-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 25173-82-4 | Molecular Weight | 228.24300 | |
| Density | 1.274g/cm3 | Boiling Point | 399ºC at 760mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.3ºC | |
| Name | 2-(2-hydroxyphenyl)-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 399ºC at 760mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 209.3ºC |
| Exact Mass | 228.07900 |
| PSA | 57.53000 |
| LogP | 2.60870 |
| Vapour Pressure | 4.39E-07mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | SXQMCNKPZIBQGQ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(c1ccccc1)c1ccccc1O |
|
~%
Benzeneacetic a... CAS#:25173-82-4 |
| Literature: Greenwood; Nierenstein Journal of the Chemical Society, 1920 , vol. 117, p. 1597 |
|
~%
Benzeneacetic a... CAS#:25173-82-4 |
| Literature: Stoermer; Kippe Chemische Berichte, 1903 , vol. 36, p. 4002 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Oxy-diphenylessigsaeure |