N,N-DIBOC-2-CHLORO-4-NITROANILINE structure
|
Common Name | N,N-DIBOC-2-CHLORO-4-NITROANILINE | ||
|---|---|---|---|---|
| CAS Number | 252019-65-1 | Molecular Weight | 372.80100 | |
| Density | 1.284g/cm3 | Boiling Point | 442.1ºC at 760 mmHg | |
| Molecular Formula | C16H21ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.2ºC | |
| Name | tert-butyl N-(2-chloro-4-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 442.1ºC at 760 mmHg |
| Molecular Formula | C16H21ClN2O6 |
| Molecular Weight | 372.80100 |
| Flash Point | 221.2ºC |
| Exact Mass | 372.10900 |
| PSA | 101.66000 |
| LogP | 5.44800 |
| Vapour Pressure | 5.15E-08mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | IDGPZGXYFQWSTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])cc1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2921420090 |
|
~99%
N,N-DIBOC-2-CHL... CAS#:252019-65-1 |
| Literature: Tsou, Hwei-Ru; Overbeek-Klumpers, Elsebe G.; Hallett, William A.; Reich, Marvin F.; Floyd, M. Brawner; Johnson, Bernard D.; Michalak, Ronald S.; Nilakantan, Ramaswamy; Discafani, Carolyn; Golas, Jonathan; Rabindran, Sridhar K.; Shen, Ru; Shi, Xiaoqing; Wang, Yu-Fen; Upeslacis, Janis; Wissner, Allan Journal of Medicinal Chemistry, 2005 , vol. 48, # 4 p. 1107 - 1131 |
|
~%
N,N-DIBOC-2-CHL... CAS#:252019-65-1 |
| Literature: US6498275 B1, ; US 6498275 B1 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N,N-bis(tert-butoxycarbonyl)-2-chloro-4-nitroaniline |
| AB3615 |
| N,N-di-(t-Butyloxycarbonyl)-2-chloro-4-nitroaniline |
| bis(tert-butyl-2-chloro-4-nitrophenyl)carbamate |
| CTK4F5198 |
| AGN-PC-01V7QG |
| N,N-DIBOC-2-CHLORO-4-NITROANILINE |