N-(3-Methoxyphenyl)-3-oxo-butanamide structure
|
Common Name | N-(3-Methoxyphenyl)-3-oxo-butanamide | ||
|---|---|---|---|---|
| CAS Number | 25233-47-0 | Molecular Weight | 207.22600 | |
| Density | 1.173g/cm3 | Boiling Point | 403.7ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198ºC | |
| Name | N-(3-methoxyphenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 403.7ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 198ºC |
| Exact Mass | 207.09000 |
| PSA | 55.40000 |
| LogP | 1.68580 |
| Vapour Pressure | 9.95E-07mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | CYZJVFQRXSTWHE-UHFFFAOYSA-N |
| SMILES | COc1cccc(NC(=O)CC(C)=O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Methoxy-acetoacetanilid |
| acetoacetyl-3-methoxyanilide |
| 3-methoxyacetoacetanilide |
| F9995-0293 |
| N-(3-Methoxyphenyl)-3-oxo-butanamide |