1,5-Dibromo-2,6-dimethoxynaphthalene structure
|
Common Name | 1,5-Dibromo-2,6-dimethoxynaphthalene | ||
|---|---|---|---|---|
| CAS Number | 25315-06-4 | Molecular Weight | 346.01500 | |
| Density | 1.696 g/cm3 | Boiling Point | 392.3ºCat 760 mmHg | |
| Molecular Formula | C12H10Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.5ºC | |
| Name | 1,5-Dibromo-2,6-dimethoxynaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.696 g/cm3 |
|---|---|
| Boiling Point | 392.3ºCat 760 mmHg |
| Molecular Formula | C12H10Br2O2 |
| Molecular Weight | 346.01500 |
| Flash Point | 161.5ºC |
| Exact Mass | 343.90500 |
| PSA | 18.46000 |
| LogP | 4.38200 |
| Vapour Pressure | 5.22E-06mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | ISDSFEXTWVVJKX-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(Br)c(OC)ccc2c1Br |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2909309090 |
|
~%
1,5-Dibromo-2,6... CAS#:25315-06-4 |
| Literature: Chakravarti; Pasupati Journal of the Chemical Society, 1937 , p. 1859,1861 |
|
~%
1,5-Dibromo-2,6... CAS#:25315-06-4 |
| Literature: Chakravarti; Pasupati Journal of the Chemical Society, 1937 , p. 1859,1861 |
|
~%
1,5-Dibromo-2,6... CAS#:25315-06-4 |
| Literature: Chakravarti; Pasupati Journal of the Chemical Society, 1937 , p. 1859,1861 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,5-dibromo-2,6-dimethoxynaphthalene |