2,6-diisopropylphenyl isothiocyanate structure
|
Common Name | 2,6-diisopropylphenyl isothiocyanate | ||
|---|---|---|---|---|
| CAS Number | 25343-70-8 | Molecular Weight | 219.34600 | |
| Density | 1,01 g/cm3 | Boiling Point | 140°C 5mm | |
| Molecular Formula | C13H17NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139-140°C/5mm | |
| Name | 2-isothiocyanato-1,3-di(propan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1,01 g/cm3 |
|---|---|
| Boiling Point | 140°C 5mm |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.34600 |
| Flash Point | 139-140°C/5mm |
| Exact Mass | 219.10800 |
| PSA | 44.45000 |
| LogP | 4.66770 |
| Vapour Pressure | 0.00139mmHg at 25°C |
| Index of Refraction | 1.5830 |
| InChIKey | HZGOUCYIYIFQHX-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(C(C)C)c1N=C=S |
| Hazard Codes | T |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 2810 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 2930909090 |
|
~90%
2,6-diisopropyl... CAS#:25343-70-8 |
| Literature: Shan; Bian; Su; Liang Organic Preparations and Procedures International, 2004 , vol. 36, # 3 p. 283 - 286 |
|
~99%
2,6-diisopropyl... CAS#:25343-70-8 |
| Literature: Habib, Nargues S.; Rieker, Anton Synthesis, 1984 , # 10 p. 825 - 827 |
|
~%
2,6-diisopropyl... CAS#:25343-70-8 |
| Literature: Journal of the American Chemical Society, , vol. 125, # 1 p. 113 - 123 |
|
~96%
2,6-diisopropyl... CAS#:25343-70-8 |
| Literature: Habib, Nargues S.; Rieker, Anton Synthesis, 1984 , # 10 p. 825 - 827 |
|
~%
2,6-diisopropyl... CAS#:25343-70-8 |
| Literature: Synthesis, , # 10 p. 825 - 827 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00041341 |
| 2,6-diisopropylphenyl isothiocyanide |
| 1,3-Diisopropyl-2-isothiocyanatobenzene |
| 2,6-DIISOPROPYLPHENYL ISOTHIOCYANATE |
| 2,6-diisopropylphenylisothiocyanate |
| 2,5-DIHYDRO-A,2,4,5-TETRAMETHYL-2-THIAZOLEMETHANETHIOLO |